C13H23N3O — CID 58298378
3-(methylamino)-1-methylidene-6-propan-2-yl-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazin-4-one (PubChem CID 58298378) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-(methylamino)-1-methylidene-6-propan-2-yl-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazin-4-one.
| Compound Name | 3-(methylamino)-1-methylidene-6-propan-2-yl-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazin-4-one |
|---|---|
| PubChem CID | 58298378 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3-(methylamino)-1-methylidene-6-propan-2-yl-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazin-4-one |
| SMILES | C=C1CC(NC)C(=O)N2C(C(C)C)CCCN12 |
| InChI | InChI=1S/C13H23N3O/c1-9(2)12-6-5-7-15-10(3)8-11(14-4)13(17)16(12)15/h9,11-12,14H,3,5-8H2,1-2,4H3 |
| InChIKey | NOIUACIPYFIBHE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |