C12H16N2 — CID 58298494
2-[4-[(1R)-1-aminoethyl]phenyl]-2-methylpropanenitrile (PubChem CID 58298494) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-[4-[(1R)-1-aminoethyl]phenyl]-2-methylpropanenitrile.
| Compound Name | 2-[4-[(1R)-1-aminoethyl]phenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 58298494 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-[4-[(1R)-1-aminoethyl]phenyl]-2-methylpropanenitrile |
| SMILES | C[C@@H](N)c1ccc(C(C)(C)C#N)cc1 |
| InChI | InChI=1S/C12H16N2/c1-9(14)10-4-6-11(7-5-10)12(2,3)8-13/h4-7,9H,14H2,1-3H3/t9-/m1/s1 |
| InChIKey | XAWKCMGGZBPCCU-SECBINFHSA-N |
| XLogP | 2.51 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |