About 3-methoxy-4,5,6-trimethyloxan-2-ol
3-methoxy-4,5,6-trimethyloxan-2-ol (PubChem CID 58298710) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-methoxy-4,5,6-trimethyloxan-2-ol.
Molecular Properties
| Compound Name | 3-methoxy-4,5,6-trimethyloxan-2-ol |
| PubChem CID | 58298710 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 3-methoxy-4,5,6-trimethyloxan-2-ol |
| SMILES | COC1C(O)OC(C)C(C)C1C |
| InChI | InChI=1S/C9H18O3/c1-5-6(2)8(11-4)9(10)12-7(5)3/h5-10H,1-4H3 |
| InChIKey | RBHYQTQOIMGBAU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-4,5,6-trimethyloxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4,5,6-trimethyloxan-2-ol?
The IUPAC name of 3-methoxy-4,5,6-trimethyloxan-2-ol (CID 58298710) is 3-methoxy-4,5,6-trimethyloxan-2-ol.
What is the SMILES notation for 3-methoxy-4,5,6-trimethyloxan-2-ol?
The canonical SMILES for 3-methoxy-4,5,6-trimethyloxan-2-ol is COC1C(O)OC(C)C(C)C1C.
What is the InChIKey of 3-methoxy-4,5,6-trimethyloxan-2-ol?
The InChIKey is RBHYQTQOIMGBAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-5-6(2)8(11-4)9(10)12-7(5)3/h5-10H,1-4H3.
What are the key properties of 3-methoxy-4,5,6-trimethyloxan-2-ol?
3-methoxy-4,5,6-trimethyloxan-2-ol has a molecular weight of 174.24 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4,5,6-trimethyloxan-2-ol is sourced from PubChem (CID 58298710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).