C33H30F6O4S — CID 58298755
5-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]-3,5-dimethylphenyl]propan-2-yl]-1,2,3-trimethylbenzene (PubChem CID 58298755) has the molecular formula C33H30F6O4S and a molecular weight of 636.65 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]-3,5-dimethylphenyl]propan-2-yl]-1,2,3-trimethylbenzene.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]-3,5-dimethylphenyl]propan-2-yl]-1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 58298755 |
| Molecular Formula | C33H30F6O4S |
| Molecular Weight | 636.65 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]-3,5-dimethylphenyl]propan-2-yl]-1,2,3-trimethylbenzene |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(Oc3c(C)cc(C(c4cc(C)c(C)c(C)c4)(C(F)(F)F)C(F)(F)F)cc3C)cc2)cc1 |
| InChI | InChI=1S/C33H30F6O4S/c1-19-15-24(16-20(2)23(19)5)31(32(34,35)36,33(37,38)39)25-17-21(3)30(22(4)18-25)43-27-9-13-29(14-10-27)44(40,41)28-11-7-26(42-6)8-12-28/h7-18H,1-6H3 |
| InChIKey | BACAXFYAVRDWAB-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.65 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |