About 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate
1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate (PubChem CID 58298913) has the molecular formula C13H19NO5
and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate.
Molecular Properties
| Compound Name | 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate |
| PubChem CID | 58298913 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate |
| SMILES | C=C(C)C(=O)NCCOC(=O)/C=C/C(=O)OC(C)C |
| InChI | InChI=1S/C13H19NO5/c1-9(2)13(17)14-7-8-18-11(15)5-6-12(16)19-10(3)4/h5-6,10H,1,7-8H2,2-4H3,(H,14,17)/b6-5+ |
| InChIKey | KTHSEAYZDUZCCK-AATRIKPKSA-N |
| XLogP | 0.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate?
The IUPAC name of 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate (CID 58298913) is 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate.
What is the SMILES notation for 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate?
The canonical SMILES for 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate is C=C(C)C(=O)NCCOC(=O)/C=C/C(=O)OC(C)C.
What is the InChIKey of 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate?
The InChIKey is KTHSEAYZDUZCCK-AATRIKPKSA-N. The full InChI is InChI=1S/C13H19NO5/c1-9(2)13(17)14-7-8-18-11(15)5-6-12(16)19-10(3)4/h5-6,10H,1,7-8H2,2-4H3,(H,14,17)/b6-5+.
What are the key properties of 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate?
1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate has a molecular weight of 269.30 g/mol, XLogP of 0.73, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(2-methylprop-2-enoylamino)ethyl] 4-O-propan-2-yl (E)-but-2-enedioate is sourced from PubChem (CID 58298913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).