C16H25NO4 — CID 58298962
propan-2-yl (E)-9-(2-methylprop-2-enoylamino)-4-oxonon-2-enoate (PubChem CID 58298962) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is propan-2-yl (E)-9-(2-methylprop-2-enoylamino)-4-oxonon-2-enoate.
| Compound Name | propan-2-yl (E)-9-(2-methylprop-2-enoylamino)-4-oxonon-2-enoate |
|---|---|
| PubChem CID | 58298962 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | propan-2-yl (E)-9-(2-methylprop-2-enoylamino)-4-oxonon-2-enoate |
| SMILES | C=C(C)C(=O)NCCCCCC(=O)/C=C/C(=O)OC(C)C |
| InChI | InChI=1S/C16H25NO4/c1-12(2)16(20)17-11-7-5-6-8-14(18)9-10-15(19)21-13(3)4/h9-10,13H,1,5-8,11H2,2-4H3,(H,17,20)/b10-9+ |
| InChIKey | CWKFUVYGWKPNKJ-MDZDMXLPSA-N |
| XLogP | 2.32 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|