About bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone
bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone (PubChem CID 58299074) has the molecular formula C57H38N4O
and a molecular weight of 794.96 g/mol. Its IUPAC name is bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone.
Molecular Properties
| Compound Name | bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone |
| PubChem CID | 58299074 |
| Molecular Formula | C57H38N4O |
| Molecular Weight | 794.96 g/mol |
| Exact Mass | 794.30 |
| IUPAC Name | bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone |
| SMILES | O=C(c1cc(-c2cccc(-c3ccccn3)c2)cc(-c2cccc(-c3ccccn3)c2)c1)c1cc(-c2cccc(-c3ccccn3)c2)cc(-c2cccc(-c3ccccn3)c2)c1 |
| InChI | InChI=1S/C57H38N4O/c62-57(51-35-47(39-13-9-17-43(29-39)53-21-1-5-25-58-53)33-48(36-51)40-14-10-18-44(30-40)54-22-2-6-26-59-54)52-37-49(41-15-11-19-45(31-41)55-23-3-7-27-60-55)34-50(38-52)42-16-12-20-46(32-42)56-24-4-8-28-61-56/h1-38H |
| InChIKey | AQIFZZRALHXZIY-UHFFFAOYSA-N |
| XLogP | 13.83 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 794.96 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone?
The IUPAC name of bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone (CID 58299074) is bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone.
What is the SMILES notation for bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone?
The canonical SMILES for bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone is O=C(c1cc(-c2cccc(-c3ccccn3)c2)cc(-c2cccc(-c3ccccn3)c2)c1)c1cc(-c2cccc(-c3ccccn3)c2)cc(-c2cccc(-c3ccccn3)c2)c1.
What is the InChIKey of bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone?
The InChIKey is AQIFZZRALHXZIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C57H38N4O/c62-57(51-35-47(39-13-9-17-43(29-39)53-21-1-5-25-58-53)33-48(36-51)40-14-10-18-44(30-40)54-22-2-6-26-59-54)52-37-49(41-15-11-19-45(31-41)55-23-3-7-27-60-55)34-50(38-52)42-16-12-20-46(32-42)56-24-4-8-28-61-56/h1-38H.
What are the key properties of bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone?
bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone has a molecular weight of 794.96 g/mol, XLogP of 13.83, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3,5-bis(3-pyridin-2-ylphenyl)phenyl]methanone is sourced from PubChem (CID 58299074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).