C39H38N6 — CID 58299191
2-[[4,6-bis(3,5-dimethylphenyl)-1,3,5-triazin-2-yl]methyl]-4,6-bis(3,5-dimethylphenyl)-1,3,5-triazine (PubChem CID 58299191) has the molecular formula C39H38N6 and a molecular weight of 590.78 g/mol. Its IUPAC name is 2-[[4,6-bis(3,5-dimethylphenyl)-1,3,5-triazin-2-yl]methyl]-4,6-bis(3,5-dimethylphenyl)-1,3,5-triazine.
| Compound Name | 2-[[4,6-bis(3,5-dimethylphenyl)-1,3,5-triazin-2-yl]methyl]-4,6-bis(3,5-dimethylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58299191 |
| Molecular Formula | C39H38N6 |
| Molecular Weight | 590.78 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | 2-[[4,6-bis(3,5-dimethylphenyl)-1,3,5-triazin-2-yl]methyl]-4,6-bis(3,5-dimethylphenyl)-1,3,5-triazine |
| SMILES | Cc1cc(C)cc(-c2nc(Cc3nc(-c4cc(C)cc(C)c4)nc(-c4cc(C)cc(C)c4)n3)nc(-c3cc(C)cc(C)c3)n2)c1 |
| InChI | InChI=1S/C39H38N6/c1-22-9-23(2)14-30(13-22)36-40-34(41-37(44-36)31-15-24(3)10-25(4)16-31)21-35-42-38(32-17-26(5)11-27(6)18-32)45-39(43-35)33-19-28(7)12-29(8)20-33/h9-20H,21H2,1-8H3 |
| InChIKey | LZMUPWGSXXDDAK-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.78 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |