C43H40F4N2O2 — CID 58299237
1-[5-(4-butoxyphenyl)-5-(4-fluorophenyl)-21,21-dimethyl-10-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-17-yl]piperazine (PubChem CID 58299237) has the molecular formula C43H40F4N2O2 and a molecular weight of 692.80 g/mol. Its IUPAC name is 1-[5-(4-butoxyphenyl)-5-(4-fluorophenyl)-21,21-dimethyl-10-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-17-yl]piperazine.
| Compound Name | 1-[5-(4-butoxyphenyl)-5-(4-fluorophenyl)-21,21-dimethyl-10-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-17-yl]piperazine |
|---|---|
| PubChem CID | 58299237 |
| Molecular Formula | C43H40F4N2O2 |
| Molecular Weight | 692.80 g/mol |
| Exact Mass | 692.30 |
| IUPAC Name | 1-[5-(4-butoxyphenyl)-5-(4-fluorophenyl)-21,21-dimethyl-10-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-17-yl]piperazine |
| SMILES | CCCCOc1ccc(C2(c3ccc(F)cc3)C=Cc3c4c(c5ccc(C(F)(F)F)cc5c3O2)-c2cc(N3CCNCC3)ccc2C4(C)C)cc1 |
| InChI | InChI=1S/C43H40F4N2O2/c1-4-5-24-50-32-14-8-28(9-15-32)42(27-6-11-30(44)12-7-27)19-18-34-39-38(33-16-10-29(43(45,46)47)25-35(33)40(34)51-42)36-26-31(49-22-20-48-21-23-49)13-17-37(36)41(39,2)3/h6-19,25-26,48H,4-5,20-24H2,1-3H3 |
| InChIKey | YTOJFACQWPSVFR-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.80 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|