C11H22N+ — CID 58299405
(4S,5S)-1,2,3,4,5,6-hexamethyl-2,3,4,5-tetrahydropyridin-1-ium (PubChem CID 58299405) has the molecular formula C11H22N+ and a molecular weight of 168.30 g/mol. Its IUPAC name is (4S,5S)-1,2,3,4,5,6-hexamethyl-2,3,4,5-tetrahydropyridin-1-ium.
| Compound Name | (4S,5S)-1,2,3,4,5,6-hexamethyl-2,3,4,5-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 58299405 |
| Molecular Formula | C11H22N+ |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.17 |
| IUPAC Name | (4S,5S)-1,2,3,4,5,6-hexamethyl-2,3,4,5-tetrahydropyridin-1-ium |
| SMILES | CC1=[N+](C)C(C)C(C)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C11H22N/c1-7-8(2)10(4)12(6)11(5)9(7)3/h7-10H,1-6H3/q+1/t7-,8?,9-,10?/m0/s1 |
| InChIKey | MPBVOGWJMHZXII-FMLYDFSMSA-N |
| XLogP | 2.40 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|