C14H27N — CID 58299412
(Z)-N,3,4,5,5,6,6-heptamethylhept-3-en-2-imine (PubChem CID 58299412) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is (Z)-N,3,4,5,5,6,6-heptamethylhept-3-en-2-imine.
| Compound Name | (Z)-N,3,4,5,5,6,6-heptamethylhept-3-en-2-imine |
|---|---|
| PubChem CID | 58299412 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (Z)-N,3,4,5,5,6,6-heptamethylhept-3-en-2-imine |
| SMILES | C/N=C(C)/C(C)=C(/C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27N/c1-10(12(3)15-9)11(2)14(7,8)13(4,5)6/h1-9H3/b11-10-,15-12+ |
| InChIKey | RHSJHUMXXGATCD-WTPCJXRQSA-N |
| XLogP | 4.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|