C24H29N9O — CID 58299571
N-[6-[4-(dimethylamino)piperidin-1-yl]pyridazin-3-yl]-8-[(3R)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58299571) has the molecular formula C24H29N9O and a molecular weight of 459.56 g/mol. Its IUPAC name is N-[6-[4-(dimethylamino)piperidin-1-yl]pyridazin-3-yl]-8-[(3R)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | N-[6-[4-(dimethylamino)piperidin-1-yl]pyridazin-3-yl]-8-[(3R)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58299571 |
| Molecular Formula | C24H29N9O |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | N-[6-[4-(dimethylamino)piperidin-1-yl]pyridazin-3-yl]-8-[(3R)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | CN(C)C1CCN(c2ccc(Nc3ncc4c5ccncc5n([C@@H]5CCOC5)c4n3)nn2)CC1 |
| InChI | InChI=1S/C24H29N9O/c1-31(2)16-6-10-32(11-7-16)22-4-3-21(29-30-22)27-24-26-13-19-18-5-9-25-14-20(18)33(23(19)28-24)17-8-12-34-15-17/h3-5,9,13-14,16-17H,6-8,10-12,15H2,1-2H3,(H,26,27,28,29)/t17-/m1/s1 |
| InChIKey | PPDIOQKFQZYJNO-QGZVFWFLSA-N |
| XLogP | 3.00 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |