C22H26N8S — CID 58299573
N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)-4-(piperazin-1-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 58299573) has the molecular formula C22H26N8S and a molecular weight of 434.57 g/mol. Its IUPAC name is N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)-4-(piperazin-1-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)-4-(piperazin-1-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58299573 |
| Molecular Formula | C22H26N8S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)-4-(piperazin-1-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | c1cc2c3cnc(Nc4nc(CN5CCNCC5)cs4)nc3n(C3CCCC3)c2cn1 |
| InChI | InChI=1S/C22H26N8S/c1-2-4-16(3-1)30-19-12-24-6-5-17(19)18-11-25-21(27-20(18)30)28-22-26-15(14-31-22)13-29-9-7-23-8-10-29/h5-6,11-12,14,16,23H,1-4,7-10,13H2,(H,25,26,27,28) |
| InChIKey | XWWYSAVKDKITGM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |