C24H26N8O — CID 58299619
[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]-piperazin-1-ylmethanone (PubChem CID 58299619) has the molecular formula C24H26N8O and a molecular weight of 442.53 g/mol. Its IUPAC name is [6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]-piperazin-1-ylmethanone.
| Compound Name | [6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 58299619 |
| Molecular Formula | C24H26N8O |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | [6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1ccc(Nc2ncc3c4ccncc4n(C4CCCC4)c3n2)nc1)N1CCNCC1 |
| InChI | InChI=1S/C24H26N8O/c33-23(31-11-9-25-10-12-31)16-5-6-21(27-13-16)29-24-28-14-19-18-7-8-26-15-20(18)32(22(19)30-24)17-3-1-2-4-17/h5-8,13-15,17,25H,1-4,9-12H2,(H,27,28,29,30) |
| InChIKey | CNEMATMUMUNODK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |