C15H14F3N5O3S — CID 58299622
(5-amino-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-10-yl) trifluoromethanesulfonate (PubChem CID 58299622) has the molecular formula C15H14F3N5O3S and a molecular weight of 401.37 g/mol. Its IUPAC name is (5-amino-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-10-yl) trifluoromethanesulfonate.
| Compound Name | (5-amino-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-10-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58299622 |
| Molecular Formula | C15H14F3N5O3S |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | (5-amino-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-10-yl) trifluoromethanesulfonate |
| SMILES | Nc1ncc2c3ccnc(OS(=O)(=O)C(F)(F)F)c3n(C3CCCC3)c2n1 |
| InChI | InChI=1S/C15H14F3N5O3S/c16-15(17,18)27(24,25)26-13-11-9(5-6-20-13)10-7-21-14(19)22-12(10)23(11)8-3-1-2-4-8/h5-8H,1-4H2,(H2,19,21,22) |
| InChIKey | QDHVSWQWZRRVJV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|