C27H32FN9O — CID 58299625
1-[4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]-2-(dimethylamino)ethanone (PubChem CID 58299625) has the molecular formula C27H32FN9O and a molecular weight of 517.61 g/mol. Its IUPAC name is 1-[4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]-2-(dimethylamino)ethanone.
| Compound Name | 1-[4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 58299625 |
| Molecular Formula | C27H32FN9O |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | 1-[4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]-2-(dimethylamino)ethanone |
| SMILES | CN(C)CC(=O)N1CCN(c2ccc(Nc3ncc4c5ccnc(F)c5n(C5CCCC5)c4n3)nc2)CC1 |
| InChI | InChI=1S/C27H32FN9O/c1-34(2)17-23(38)36-13-11-35(12-14-36)19-7-8-22(30-15-19)32-27-31-16-21-20-9-10-29-25(28)24(20)37(26(21)33-27)18-5-3-4-6-18/h7-10,15-16,18H,3-6,11-14,17H2,1-2H3,(H,30,31,32,33) |
| InChIKey | DJMXSTXUOFSZSZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|