C25H27FN8O2 — CID 58299647
methyl 4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazine-1-carboxylate (PubChem CID 58299647) has the molecular formula C25H27FN8O2 and a molecular weight of 490.54 g/mol. Its IUPAC name is methyl 4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58299647 |
| Molecular Formula | C25H27FN8O2 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | methyl 4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(c2ccc(Nc3ncc4c5ccnc(F)c5n(C5CCCC5)c4n3)nc2)CC1 |
| InChI | InChI=1S/C25H27FN8O2/c1-36-25(35)33-12-10-32(11-13-33)17-6-7-20(28-14-17)30-24-29-15-19-18-8-9-27-22(26)21(18)34(23(19)31-24)16-4-2-3-5-16/h6-9,14-16H,2-5,10-13H2,1H3,(H,28,29,30,31) |
| InChIKey | DTOHHEHNWCGIBY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|