C22H22N6O2 — CID 58299657
ethyl 6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridine-3-carboxylate (PubChem CID 58299657) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is ethyl 6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 58299657 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | ethyl 6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(Nc2ncc3c4ccncc4n(C4CCCC4)c3n2)nc1 |
| InChI | InChI=1S/C22H22N6O2/c1-2-30-21(29)14-7-8-19(24-11-14)26-22-25-12-17-16-9-10-23-13-18(16)28(20(17)27-22)15-5-3-4-6-15/h7-13,15H,2-6H2,1H3,(H,24,25,26,27) |
| InChIKey | QZYAVJILOBPGHD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |