C23H26FN9 — CID 58299661
8-cyclopentyl-10-fluoro-N-[6-[(3R)-3-methylpiperazin-1-yl]pyridazin-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58299661) has the molecular formula C23H26FN9 and a molecular weight of 447.52 g/mol. Its IUPAC name is 8-cyclopentyl-10-fluoro-N-[6-[(3R)-3-methylpiperazin-1-yl]pyridazin-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-cyclopentyl-10-fluoro-N-[6-[(3R)-3-methylpiperazin-1-yl]pyridazin-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58299661 |
| Molecular Formula | C23H26FN9 |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 8-cyclopentyl-10-fluoro-N-[6-[(3R)-3-methylpiperazin-1-yl]pyridazin-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | C[C@@H]1CN(c2ccc(Nc3ncc4c5ccnc(F)c5n(C5CCCC5)c4n3)nn2)CCN1 |
| InChI | InChI=1S/C23H26FN9/c1-14-13-32(11-10-25-14)19-7-6-18(30-31-19)28-23-27-12-17-16-8-9-26-21(24)20(16)33(22(17)29-23)15-4-2-3-5-15/h6-9,12,14-15,25H,2-5,10-11,13H2,1H3,(H,27,28,29,30)/t14-/m1/s1 |
| InChIKey | MAVGAHAOCLDZKW-CQSZACIVSA-N |
| XLogP | 3.57 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|