C22H23N7O2 — CID 58299671
(3R)-1-[6-[[8-[(3S)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl]amino]-3-pyridinyl]pyrrolidin-3-ol (PubChem CID 58299671) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is (3R)-1-[6-[[8-[(3S)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl]amino]-3-pyridinyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[6-[[8-[(3S)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl]amino]-3-pyridinyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 58299671 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (3R)-1-[6-[[8-[(3S)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl]amino]-3-pyridinyl]pyrrolidin-3-ol |
| SMILES | O[C@@H]1CCN(c2ccc(Nc3ncc4c5ccncc5n([C@H]5CCOC5)c4n3)nc2)C1 |
| InChI | InChI=1S/C22H23N7O2/c30-16-4-7-28(12-16)14-1-2-20(24-9-14)26-22-25-10-18-17-3-6-23-11-19(17)29(21(18)27-22)15-5-8-31-13-15/h1-3,6,9-11,15-16,30H,4-5,7-8,12-13H2,(H,24,25,26,27)/t15-,16+/m0/s1 |
| InChIKey | LGXOHAYRPOPZFR-JKSUJKDBSA-N |
| XLogP | 2.65 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |