C27H32N8 — CID 58299686
8-cyclopentyl-N-[5-(1,8-diazaspiro[4.5]decan-8-yl)-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58299686) has the molecular formula C27H32N8 and a molecular weight of 468.61 g/mol. Its IUPAC name is 8-cyclopentyl-N-[5-(1,8-diazaspiro[4.5]decan-8-yl)-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-cyclopentyl-N-[5-(1,8-diazaspiro[4.5]decan-8-yl)-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58299686 |
| Molecular Formula | C27H32N8 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 8-cyclopentyl-N-[5-(1,8-diazaspiro[4.5]decan-8-yl)-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | c1cc2c3cnc(Nc4ccc(N5CCC6(CCCN6)CC5)cn4)nc3n(C3CCCC3)c2cn1 |
| InChI | InChI=1S/C27H32N8/c1-2-5-19(4-1)35-23-18-28-13-8-21(23)22-17-30-26(33-25(22)35)32-24-7-6-20(16-29-24)34-14-10-27(11-15-34)9-3-12-31-27/h6-8,13,16-19,31H,1-5,9-12,14-15H2,(H,29,30,32,33) |
| InChIKey | IILDUAYEAWGHSQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |