C30H37FN8O2 — CID 58299696
tert-butyl (2S)-4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]-2-ethylpiperazine-1-carboxylate (PubChem CID 58299696) has the molecular formula C30H37FN8O2 and a molecular weight of 560.68 g/mol. Its IUPAC name is tert-butyl (2S)-4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]-2-ethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]-2-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 58299696 |
| Molecular Formula | C30H37FN8O2 |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | tert-butyl (2S)-4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]-2-ethylpiperazine-1-carboxylate |
| SMILES | CC[C@H]1CN(c2ccc(Nc3ncc4c5ccnc(F)c5n(C5CCCC5)c4n3)nc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H37FN8O2/c1-5-19-18-37(14-15-38(19)29(40)41-30(2,3)4)21-10-11-24(33-16-21)35-28-34-17-23-22-12-13-32-26(31)25(22)39(27(23)36-28)20-8-6-7-9-20/h10-13,16-17,19-20H,5-9,14-15,18H2,1-4H3,(H,33,34,35,36)/t19-/m0/s1 |
| InChIKey | AVHWHASIYUKVTC-IBGZPJMESA-N |
| XLogP | 6.21 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|