C23H24FN7O — CID 58299703
(3R)-1-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]pyrrolidin-3-ol (PubChem CID 58299703) has the molecular formula C23H24FN7O and a molecular weight of 433.49 g/mol. Its IUPAC name is (3R)-1-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 58299703 |
| Molecular Formula | C23H24FN7O |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (3R)-1-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]pyrrolidin-3-ol |
| SMILES | O[C@@H]1CCN(c2ccc(Nc3ncc4c5ccnc(F)c5n(C5CCCC5)c4n3)nc2)C1 |
| InChI | InChI=1S/C23H24FN7O/c24-21-20-17(7-9-25-21)18-12-27-23(29-22(18)31(20)14-3-1-2-4-14)28-19-6-5-15(11-26-19)30-10-8-16(32)13-30/h5-7,9,11-12,14,16,32H,1-4,8,10,13H2,(H,26,27,28,29)/t16-/m1/s1 |
| InChIKey | CFZGMAQTSTWGSI-MRXNPFEDSA-N |
| XLogP | 3.94 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|