C26H29N9O2 — CID 58299731
9-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 58299731) has the molecular formula C26H29N9O2 and a molecular weight of 499.58 g/mol. Its IUPAC name is 9-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 58299731 |
| Molecular Formula | C26H29N9O2 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 9-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1COC2(CCN(c3ccc(Nc4ncc5c6ccncc6n(C6CCCC6)c5n4)nn3)CC2)CN1 |
| InChI | InChI=1S/C26H29N9O2/c36-23-15-37-26(16-29-23)8-11-34(12-9-26)22-6-5-21(32-33-22)30-25-28-13-19-18-7-10-27-14-20(18)35(24(19)31-25)17-3-1-2-4-17/h5-7,10,13-14,17H,1-4,8-9,11-12,15-16H2,(H,29,36)(H,28,30,31,32) |
| InChIKey | ZNCMRHDGBSEBTP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |