C26H33N9O — CID 58299752
(2S)-2-[[1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]piperidin-4-yl]amino]propan-1-ol (PubChem CID 58299752) has the molecular formula C26H33N9O and a molecular weight of 487.61 g/mol. Its IUPAC name is (2S)-2-[[1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]piperidin-4-yl]amino]propan-1-ol.
| Compound Name | (2S)-2-[[1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]piperidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 58299752 |
| Molecular Formula | C26H33N9O |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | (2S)-2-[[1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]piperidin-4-yl]amino]propan-1-ol |
| SMILES | C[C@@H](CO)NC1CCN(c2ccc(Nc3ncc4c5ccncc5n(C5CCCC5)c4n3)nn2)CC1 |
| InChI | InChI=1S/C26H33N9O/c1-17(16-36)29-18-9-12-34(13-10-18)24-7-6-23(32-33-24)30-26-28-14-21-20-8-11-27-15-22(20)35(25(21)31-26)19-4-2-3-5-19/h6-8,11,14-15,17-19,29,36H,2-5,9-10,12-13,16H2,1H3,(H,28,30,31,32)/t17-/m0/s1 |
| InChIKey | NRMCNHRZOLZAMB-KRWDZBQOSA-N |
| XLogP | 3.57 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |