C23H26N8O — CID 58299762
8-cyclopentyl-5-[(5-piperazin-1-yl-2-pyridinyl)amino]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,12-pentaen-10-one (PubChem CID 58299762) has the molecular formula C23H26N8O and a molecular weight of 430.52 g/mol. Its IUPAC name is 8-cyclopentyl-5-[(5-piperazin-1-yl-2-pyridinyl)amino]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,12-pentaen-10-one.
| Compound Name | 8-cyclopentyl-5-[(5-piperazin-1-yl-2-pyridinyl)amino]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,12-pentaen-10-one |
|---|---|
| PubChem CID | 58299762 |
| Molecular Formula | C23H26N8O |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 8-cyclopentyl-5-[(5-piperazin-1-yl-2-pyridinyl)amino]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,12-pentaen-10-one |
| SMILES | O=c1[nH]ccc2c3cnc(Nc4ccc(N5CCNCC5)cn4)nc3n(C3CCCC3)c12 |
| InChI | InChI=1S/C23H26N8O/c32-22-20-17(7-8-25-22)18-14-27-23(29-21(18)31(20)15-3-1-2-4-15)28-19-6-5-16(13-26-19)30-11-9-24-10-12-30/h5-8,13-15,24H,1-4,9-12H2,(H,25,32)(H,26,27,28,29) |
| InChIKey | CYWGQHJAUWDZKC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |