C25H31N9S — CID 58299763
N-[6-[4-(dimethylamino)piperidin-1-yl]pyridazin-3-yl]-8-(thian-4-yl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58299763) has the molecular formula C25H31N9S and a molecular weight of 489.65 g/mol. Its IUPAC name is N-[6-[4-(dimethylamino)piperidin-1-yl]pyridazin-3-yl]-8-(thian-4-yl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | N-[6-[4-(dimethylamino)piperidin-1-yl]pyridazin-3-yl]-8-(thian-4-yl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58299763 |
| Molecular Formula | C25H31N9S |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | N-[6-[4-(dimethylamino)piperidin-1-yl]pyridazin-3-yl]-8-(thian-4-yl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | CN(C)C1CCN(c2ccc(Nc3ncc4c5ccncc5n(C5CCSCC5)c4n3)nn2)CC1 |
| InChI | InChI=1S/C25H31N9S/c1-32(2)17-6-11-33(12-7-17)23-4-3-22(30-31-23)28-25-27-15-20-19-5-10-26-16-21(19)34(24(20)29-25)18-8-13-35-14-9-18/h3-5,10,15-18H,6-9,11-14H2,1-2H3,(H,27,28,29,30) |
| InChIKey | HDNDLSPZWCOHIC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |