C26H31N9O2 — CID 58299768
ethyl 2-[4-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]piperazin-1-yl]acetate (PubChem CID 58299768) has the molecular formula C26H31N9O2 and a molecular weight of 501.60 g/mol. Its IUPAC name is ethyl 2-[4-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 58299768 |
| Molecular Formula | C26H31N9O2 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | ethyl 2-[4-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(c2ccc(Nc3ncc4c5ccncc5n(C5CCCC5)c4n3)nn2)CC1 |
| InChI | InChI=1S/C26H31N9O2/c1-2-37-24(36)17-33-11-13-34(14-12-33)23-8-7-22(31-32-23)29-26-28-15-20-19-9-10-27-16-21(19)35(25(20)30-26)18-5-3-4-6-18/h7-10,15-16,18H,2-6,11-14,17H2,1H3,(H,28,29,30,31) |
| InChIKey | HVGWRZOBPIJOSS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |