C26H32N8O2S — CID 58299788
8-cyclopentyl-N-[5-[4-(dimethylamino)piperidin-1-yl]sulfonyl-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58299788) has the molecular formula C26H32N8O2S and a molecular weight of 520.66 g/mol. Its IUPAC name is 8-cyclopentyl-N-[5-[4-(dimethylamino)piperidin-1-yl]sulfonyl-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-cyclopentyl-N-[5-[4-(dimethylamino)piperidin-1-yl]sulfonyl-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58299788 |
| Molecular Formula | C26H32N8O2S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 8-cyclopentyl-N-[5-[4-(dimethylamino)piperidin-1-yl]sulfonyl-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | CN(C)C1CCN(S(=O)(=O)c2ccc(Nc3ncc4c5ccncc5n(C5CCCC5)c4n3)nc2)CC1 |
| InChI | InChI=1S/C26H32N8O2S/c1-32(2)18-10-13-33(14-11-18)37(35,36)20-7-8-24(28-15-20)30-26-29-16-22-21-9-12-27-17-23(21)34(25(22)31-26)19-5-3-4-6-19/h7-9,12,15-19H,3-6,10-11,13-14H2,1-2H3,(H,28,29,30,31) |
| InChIKey | RJOAAVPWGOLZSU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |