C27H29FN8O3 — CID 58299797
[2-[4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]-2-oxoethyl] acetate (PubChem CID 58299797) has the molecular formula C27H29FN8O3 and a molecular weight of 532.58 g/mol. Its IUPAC name is [2-[4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 58299797 |
| Molecular Formula | C27H29FN8O3 |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | [2-[4-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)N1CCN(c2ccc(Nc3ncc4c5ccnc(F)c5n(C5CCCC5)c4n3)nc2)CC1 |
| InChI | InChI=1S/C27H29FN8O3/c1-17(37)39-16-23(38)35-12-10-34(11-13-35)19-6-7-22(30-14-19)32-27-31-15-21-20-8-9-29-25(28)24(20)36(26(21)33-27)18-4-2-3-5-18/h6-9,14-15,18H,2-5,10-13,16H2,1H3,(H,30,31,32,33) |
| InChIKey | RZZYZYZKMBHXEB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|