C28H33ClN8O2 — CID 58299799
tert-butyl 4-[6-[(10-chloro-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazine-1-carboxylate (PubChem CID 58299799) has the molecular formula C28H33ClN8O2 and a molecular weight of 549.08 g/mol. Its IUPAC name is tert-butyl 4-[6-[(10-chloro-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[(10-chloro-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58299799 |
| Molecular Formula | C28H33ClN8O2 |
| Molecular Weight | 549.08 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | tert-butyl 4-[6-[(10-chloro-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Nc3ncc4c5ccnc(Cl)c5n(C5CCCC5)c4n3)nc2)CC1 |
| InChI | InChI=1S/C28H33ClN8O2/c1-28(2,3)39-27(38)36-14-12-35(13-15-36)19-8-9-22(31-16-19)33-26-32-17-21-20-10-11-30-24(29)23(20)37(25(21)34-26)18-6-4-5-7-18/h8-11,16-18H,4-7,12-15H2,1-3H3,(H,31,32,33,34) |
| InChIKey | YJLFSVNWDMCEGV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.08 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|