C23H25N7O2S — CID 58299884
8-cyclopentyl-N-[5-(1,1-dioxo-1,4-thiazinan-4-yl)-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58299884) has the molecular formula C23H25N7O2S and a molecular weight of 463.57 g/mol. Its IUPAC name is 8-cyclopentyl-N-[5-(1,1-dioxo-1,4-thiazinan-4-yl)-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-cyclopentyl-N-[5-(1,1-dioxo-1,4-thiazinan-4-yl)-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58299884 |
| Molecular Formula | C23H25N7O2S |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 8-cyclopentyl-N-[5-(1,1-dioxo-1,4-thiazinan-4-yl)-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | O=S1(=O)CCN(c2ccc(Nc3ncc4c5ccncc5n(C5CCCC5)c4n3)nc2)CC1 |
| InChI | InChI=1S/C23H25N7O2S/c31-33(32)11-9-29(10-12-33)17-5-6-21(25-13-17)27-23-26-14-19-18-7-8-24-15-20(18)30(22(19)28-23)16-3-1-2-4-16/h5-8,13-16H,1-4,9-12H2,(H,25,26,27,28) |
| InChIKey | HKVDMDVJPHFROE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |