C24H25FN8O — CID 58299885
[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]-piperazin-1-ylmethanone (PubChem CID 58299885) has the molecular formula C24H25FN8O and a molecular weight of 460.52 g/mol. Its IUPAC name is [6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]-piperazin-1-ylmethanone.
| Compound Name | [6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 58299885 |
| Molecular Formula | C24H25FN8O |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1ccc(Nc2ncc3c4ccnc(F)c4n(C4CCCC4)c3n2)nc1)N1CCNCC1 |
| InChI | InChI=1S/C24H25FN8O/c25-21-20-17(7-8-27-21)18-14-29-24(31-22(18)33(20)16-3-1-2-4-16)30-19-6-5-15(13-28-19)23(34)32-11-9-26-10-12-32/h5-8,13-14,16,26H,1-4,9-12H2,(H,28,29,30,31) |
| InChIKey | HZKSFMLZMFUHMI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|