C28H35N9O — CID 58299891
1-[1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]piperidin-4-yl]piperidin-4-ol (PubChem CID 58299891) has the molecular formula C28H35N9O and a molecular weight of 513.65 g/mol. Its IUPAC name is 1-[1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]piperidin-4-yl]piperidin-4-ol.
| Compound Name | 1-[1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]piperidin-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 58299891 |
| Molecular Formula | C28H35N9O |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 1-[1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]piperidin-4-yl]piperidin-4-ol |
| SMILES | OC1CCN(C2CCN(c3ccc(Nc4ncc5c6ccncc6n(C6CCCC6)c5n4)nn3)CC2)CC1 |
| InChI | InChI=1S/C28H35N9O/c38-21-10-15-35(16-11-21)19-8-13-36(14-9-19)26-6-5-25(33-34-26)31-28-30-17-23-22-7-12-29-18-24(22)37(27(23)32-28)20-3-1-2-4-20/h5-7,12,17-21,38H,1-4,8-11,13-16H2,(H,30,31,32,33) |
| InChIKey | DXKQFNWEGVJNQT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |