C24H27N7O — CID 58299910
8-cyclopentyl-N-[5-(3-methoxypyrrolidin-1-yl)-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58299910) has the molecular formula C24H27N7O and a molecular weight of 429.53 g/mol. Its IUPAC name is 8-cyclopentyl-N-[5-(3-methoxypyrrolidin-1-yl)-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-cyclopentyl-N-[5-(3-methoxypyrrolidin-1-yl)-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58299910 |
| Molecular Formula | C24H27N7O |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 8-cyclopentyl-N-[5-(3-methoxypyrrolidin-1-yl)-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | COC1CCN(c2ccc(Nc3ncc4c5ccncc5n(C5CCCC5)c4n3)nc2)C1 |
| InChI | InChI=1S/C24H27N7O/c1-32-18-9-11-30(15-18)17-6-7-22(26-12-17)28-24-27-13-20-19-8-10-25-14-21(19)31(23(20)29-24)16-4-2-3-5-16/h6-8,10,12-14,16,18H,2-5,9,11,15H2,1H3,(H,26,27,28,29) |
| InChIKey | KUMIVUZAYASXOI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |