C23H26N8O2S — CID 58299914
8-cyclopentyl-N-(5-piperazin-1-ylsulfonyl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58299914) has the molecular formula C23H26N8O2S and a molecular weight of 478.58 g/mol. Its IUPAC name is 8-cyclopentyl-N-(5-piperazin-1-ylsulfonyl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-cyclopentyl-N-(5-piperazin-1-ylsulfonyl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58299914 |
| Molecular Formula | C23H26N8O2S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 8-cyclopentyl-N-(5-piperazin-1-ylsulfonyl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | O=S(=O)(c1ccc(Nc2ncc3c4ccncc4n(C4CCCC4)c3n2)nc1)N1CCNCC1 |
| InChI | InChI=1S/C23H26N8O2S/c32-34(33,30-11-9-24-10-12-30)17-5-6-21(26-13-17)28-23-27-14-19-18-7-8-25-15-20(18)31(22(19)29-23)16-3-1-2-4-16/h5-8,13-16,24H,1-4,9-12H2,(H,26,27,28,29) |
| InChIKey | XGQSZIVZWJHPHL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |