C22H24FN7OS — CID 58299957
(3S)-1-[[2-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-1,3-thiazol-4-yl]methyl]pyrrolidin-3-ol (PubChem CID 58299957) has the molecular formula C22H24FN7OS and a molecular weight of 453.55 g/mol. Its IUPAC name is (3S)-1-[[2-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-1,3-thiazol-4-yl]methyl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[[2-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-1,3-thiazol-4-yl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 58299957 |
| Molecular Formula | C22H24FN7OS |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (3S)-1-[[2-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-1,3-thiazol-4-yl]methyl]pyrrolidin-3-ol |
| SMILES | O[C@H]1CCN(Cc2csc(Nc3ncc4c5ccnc(F)c5n(C5CCCC5)c4n3)n2)C1 |
| InChI | InChI=1S/C22H24FN7OS/c23-19-18-16(5-7-24-19)17-9-25-21(27-20(17)30(18)14-3-1-2-4-14)28-22-26-13(12-32-22)10-29-8-6-15(31)11-29/h5,7,9,12,14-15,31H,1-4,6,8,10-11H2,(H,25,26,27,28)/t15-/m0/s1 |
| InChIKey | NLFOYPRDIYQCLG-HNNXBMFYSA-N |
| XLogP | 4.00 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|