C25H31N9O — CID 58299976
(3R,4R)-1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-3-(dimethylamino)piperidin-4-ol (PubChem CID 58299976) has the molecular formula C25H31N9O and a molecular weight of 473.59 g/mol. Its IUPAC name is (3R,4R)-1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-3-(dimethylamino)piperidin-4-ol.
| Compound Name | (3R,4R)-1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-3-(dimethylamino)piperidin-4-ol |
|---|---|
| PubChem CID | 58299976 |
| Molecular Formula | C25H31N9O |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | (3R,4R)-1-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-3-(dimethylamino)piperidin-4-ol |
| SMILES | CN(C)[C@@H]1CN(c2ccc(Nc3ncc4c5ccncc5n(C5CCCC5)c4n3)nn2)CC[C@H]1O |
| InChI | InChI=1S/C25H31N9O/c1-32(2)20-15-33(12-10-21(20)35)23-8-7-22(30-31-23)28-25-27-13-18-17-9-11-26-14-19(17)34(24(18)29-25)16-5-3-4-6-16/h7-9,11,13-14,16,20-21,35H,3-6,10,12,15H2,1-2H3,(H,27,28,29,30)/t20-,21-/m1/s1 |
| InChIKey | XNFJUHZLDMOZHP-NHCUHLMSSA-N |
| XLogP | 3.13 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |