C22H24N8OS — CID 58299994
[2-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-1,3-thiazol-4-yl]-piperazin-1-ylmethanone (PubChem CID 58299994) has the molecular formula C22H24N8OS and a molecular weight of 448.56 g/mol. Its IUPAC name is [2-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-1,3-thiazol-4-yl]-piperazin-1-ylmethanone.
| Compound Name | [2-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-1,3-thiazol-4-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 58299994 |
| Molecular Formula | C22H24N8OS |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [2-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-1,3-thiazol-4-yl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1csc(Nc2ncc3c4ccncc4n(C4CCCC4)c3n2)n1)N1CCNCC1 |
| InChI | InChI=1S/C22H24N8OS/c31-20(29-9-7-23-8-10-29)17-13-32-22(26-17)28-21-25-11-16-15-5-6-24-12-18(15)30(19(16)27-21)14-3-1-2-4-14/h5-6,11-14,23H,1-4,7-10H2,(H,25,26,27,28) |
| InChIKey | FICIRDHVWSBGDI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |