C25H29ClN8O — CID 58300043
2-[4-[6-[(10-chloro-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]ethanol (PubChem CID 58300043) has the molecular formula C25H29ClN8O and a molecular weight of 493.02 g/mol. Its IUPAC name is 2-[4-[6-[(10-chloro-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[6-[(10-chloro-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 58300043 |
| Molecular Formula | C25H29ClN8O |
| Molecular Weight | 493.02 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 2-[4-[6-[(10-chloro-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(c2ccc(Nc3ncc4c5ccnc(Cl)c5n(C5CCCC5)c4n3)nc2)CC1 |
| InChI | InChI=1S/C25H29ClN8O/c26-23-22-19(7-8-27-23)20-16-29-25(31-24(20)34(22)17-3-1-2-4-17)30-21-6-5-18(15-28-21)33-11-9-32(10-12-33)13-14-35/h5-8,15-17,35H,1-4,9-14H2,(H,28,29,30,31) |
| InChIKey | FVABXVRUELQSAP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.02 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|