C22H25N7O — CID 58300047
(3R)-1-[6-[[8-[(2S)-butan-2-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl]amino]-3-pyridinyl]pyrrolidin-3-ol (PubChem CID 58300047) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is (3R)-1-[6-[[8-[(2S)-butan-2-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl]amino]-3-pyridinyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[6-[[8-[(2S)-butan-2-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl]amino]-3-pyridinyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 58300047 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (3R)-1-[6-[[8-[(2S)-butan-2-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl]amino]-3-pyridinyl]pyrrolidin-3-ol |
| SMILES | CC[C@H](C)n1c2cnccc2c2cnc(Nc3ccc(N4CC[C@@H](O)C4)cn3)nc21 |
| InChI | InChI=1S/C22H25N7O/c1-3-14(2)29-19-12-23-8-6-17(19)18-11-25-22(27-21(18)29)26-20-5-4-15(10-24-20)28-9-7-16(30)13-28/h4-6,8,10-12,14,16,30H,3,7,9,13H2,1-2H3,(H,24,25,26,27)/t14-,16+/m0/s1 |
| InChIKey | VBKQQDIWFTTXHE-GOEBONIOSA-N |
| XLogP | 3.66 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |