C24H28N8O — CID 58300061
N-[5-[4-(methylamino)piperidin-1-yl]-2-pyridinyl]-8-[(3R)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58300061) has the molecular formula C24H28N8O and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[5-[4-(methylamino)piperidin-1-yl]-2-pyridinyl]-8-[(3R)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | N-[5-[4-(methylamino)piperidin-1-yl]-2-pyridinyl]-8-[(3R)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58300061 |
| Molecular Formula | C24H28N8O |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N-[5-[4-(methylamino)piperidin-1-yl]-2-pyridinyl]-8-[(3R)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | CNC1CCN(c2ccc(Nc3ncc4c5ccncc5n([C@@H]5CCOC5)c4n3)nc2)CC1 |
| InChI | InChI=1S/C24H28N8O/c1-25-16-5-9-31(10-6-16)17-2-3-22(27-12-17)29-24-28-13-20-19-4-8-26-14-21(19)32(23(20)30-24)18-7-11-33-15-18/h2-4,8,12-14,16,18,25H,5-7,9-11,15H2,1H3,(H,27,28,29,30)/t18-/m1/s1 |
| InChIKey | NYKUNXOUARVROA-GOSISDBHSA-N |
| XLogP | 3.27 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |