C24H28N8O — CID 58300082
N-[5-(3,3-dimethylpiperazin-1-yl)-2-pyridinyl]-8-[(3R)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58300082) has the molecular formula C24H28N8O and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[5-(3,3-dimethylpiperazin-1-yl)-2-pyridinyl]-8-[(3R)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | N-[5-(3,3-dimethylpiperazin-1-yl)-2-pyridinyl]-8-[(3R)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58300082 |
| Molecular Formula | C24H28N8O |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N-[5-(3,3-dimethylpiperazin-1-yl)-2-pyridinyl]-8-[(3R)-oxolan-3-yl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | CC1(C)CN(c2ccc(Nc3ncc4c5ccncc5n([C@@H]5CCOC5)c4n3)nc2)CCN1 |
| InChI | InChI=1S/C24H28N8O/c1-24(2)15-31(9-8-28-24)16-3-4-21(26-11-16)29-23-27-12-19-18-5-7-25-13-20(18)32(22(19)30-23)17-6-10-33-14-17/h3-5,7,11-13,17,28H,6,8-10,14-15H2,1-2H3,(H,26,27,29,30)/t17-/m1/s1 |
| InChIKey | YQFRVSSFOVLVJG-QGZVFWFLSA-N |
| XLogP | 3.27 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |