C28H32N8 — CID 58300092
8-(1-adamantyl)-N-(5-piperazin-1-yl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58300092) has the molecular formula C28H32N8 and a molecular weight of 480.62 g/mol. Its IUPAC name is 8-(1-adamantyl)-N-(5-piperazin-1-yl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-(1-adamantyl)-N-(5-piperazin-1-yl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58300092 |
| Molecular Formula | C28H32N8 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 8-(1-adamantyl)-N-(5-piperazin-1-yl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | c1cc2c3cnc(Nc4ccc(N5CCNCC5)cn4)nc3n(C34CC5CC(CC(C5)C3)C4)c2cn1 |
| InChI | InChI=1S/C28H32N8/c1-2-25(31-15-21(1)35-7-5-29-6-8-35)33-27-32-16-23-22-3-4-30-17-24(22)36(26(23)34-27)28-12-18-9-19(13-28)11-20(10-18)14-28/h1-4,15-20,29H,5-14H2,(H,31,32,33,34) |
| InChIKey | DSNHCXNKKZEERJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |