C25H28N8O — CID 58300101
1-[4-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]ethanone (PubChem CID 58300101) has the molecular formula C25H28N8O and a molecular weight of 456.55 g/mol. Its IUPAC name is 1-[4-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 58300101 |
| Molecular Formula | C25H28N8O |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 1-[4-[6-[(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(Nc3ncc4c5ccncc5n(C5CCCC5)c4n3)nc2)CC1 |
| InChI | InChI=1S/C25H28N8O/c1-17(34)31-10-12-32(13-11-31)19-6-7-23(27-14-19)29-25-28-15-21-20-8-9-26-16-22(20)33(24(21)30-25)18-4-2-3-5-18/h6-9,14-16,18H,2-5,10-13H2,1H3,(H,27,28,29,30) |
| InChIKey | ILSJQLHZVCNYKY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |