C21H24N8O — CID 58300114
8-(2-methoxyethyl)-N-(5-piperazin-1-yl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58300114) has the molecular formula C21H24N8O and a molecular weight of 404.48 g/mol. Its IUPAC name is 8-(2-methoxyethyl)-N-(5-piperazin-1-yl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-(2-methoxyethyl)-N-(5-piperazin-1-yl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58300114 |
| Molecular Formula | C21H24N8O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 8-(2-methoxyethyl)-N-(5-piperazin-1-yl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | COCCn1c2cnccc2c2cnc(Nc3ccc(N4CCNCC4)cn3)nc21 |
| InChI | InChI=1S/C21H24N8O/c1-30-11-10-29-18-14-23-5-4-16(18)17-13-25-21(27-20(17)29)26-19-3-2-15(12-24-19)28-8-6-22-7-9-28/h2-5,12-14,22H,6-11H2,1H3,(H,24,25,26,27) |
| InChIKey | SNSZKJPBYIHUPY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |