C28H32FN9O2 — CID 58300130
tert-butyl N-[(1S,5R)-3-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-3-azabicyclo[3.1.0]hexan-6-yl]carbamate (PubChem CID 58300130) has the molecular formula C28H32FN9O2 and a molecular weight of 545.62 g/mol. Its IUPAC name is tert-butyl N-[(1S,5R)-3-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-3-azabicyclo[3.1.0]hexan-6-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,5R)-3-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-3-azabicyclo[3.1.0]hexan-6-yl]carbamate |
|---|---|
| PubChem CID | 58300130 |
| Molecular Formula | C28H32FN9O2 |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | tert-butyl N-[(1S,5R)-3-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]pyridazin-3-yl]-3-azabicyclo[3.1.0]hexan-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1[C@H]2CN(c3ccc(Nc4ncc5c6ccnc(F)c6n(C6CCCC6)c5n4)nn3)C[C@@H]12 |
| InChI | InChI=1S/C28H32FN9O2/c1-28(2,3)40-27(39)33-22-18-13-37(14-19(18)22)21-9-8-20(35-36-21)32-26-31-12-17-16-10-11-30-24(29)23(16)38(25(17)34-26)15-6-4-5-7-15/h8-12,15,18-19,22H,4-7,13-14H2,1-3H3,(H,33,39)(H,31,32,34,35)/t18-,19+,22? |
| InChIKey | PIETWDSBVWAEDM-QIDMFYOTSA-N |
| XLogP | 4.73 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|