C23H25N7O2S — CID 58300151
2-N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)-5-N-(1,1-dioxothiolan-3-yl)pyridine-2,5-diamine (PubChem CID 58300151) has the molecular formula C23H25N7O2S and a molecular weight of 463.57 g/mol. Its IUPAC name is 2-N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)-5-N-(1,1-dioxothiolan-3-yl)pyridine-2,5-diamine.
| Compound Name | 2-N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)-5-N-(1,1-dioxothiolan-3-yl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 58300151 |
| Molecular Formula | C23H25N7O2S |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 2-N-(8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)-5-N-(1,1-dioxothiolan-3-yl)pyridine-2,5-diamine |
| SMILES | O=S1(=O)CCC(Nc2ccc(Nc3ncc4c5ccncc5n(C5CCCC5)c4n3)nc2)C1 |
| InChI | InChI=1S/C23H25N7O2S/c31-33(32)10-8-16(14-33)27-15-5-6-21(25-11-15)28-23-26-12-19-18-7-9-24-13-20(18)30(22(19)29-23)17-3-1-2-4-17/h5-7,9,11-13,16-17,27H,1-4,8,10,14H2,(H,25,26,28,29) |
| InChIKey | QYKOXFSITMBUDO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |