C25H24N8O — CID 58300153
8-(4-methoxyphenyl)-N-(5-piperazin-1-yl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58300153) has the molecular formula C25H24N8O and a molecular weight of 452.52 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)-N-(5-piperazin-1-yl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-(4-methoxyphenyl)-N-(5-piperazin-1-yl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58300153 |
| Molecular Formula | C25H24N8O |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 8-(4-methoxyphenyl)-N-(5-piperazin-1-yl-2-pyridinyl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | COc1ccc(-n2c3cnccc3c3cnc(Nc4ccc(N5CCNCC5)cn4)nc32)cc1 |
| InChI | InChI=1S/C25H24N8O/c1-34-19-5-2-17(3-6-19)33-22-16-27-9-8-20(22)21-15-29-25(31-24(21)33)30-23-7-4-18(14-28-23)32-12-10-26-11-13-32/h2-9,14-16,26H,10-13H2,1H3,(H,28,29,30,31) |
| InChIKey | WNBOZMLWGXPGLO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |