C27H33N9 — CID 58300171
8-cyclopentyl-N-[5-(4-pyrrolidin-1-ylpiperidin-1-yl)-2-pyridinyl]-4,6,8,10,11-pentazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58300171) has the molecular formula C27H33N9 and a molecular weight of 483.62 g/mol. Its IUPAC name is 8-cyclopentyl-N-[5-(4-pyrrolidin-1-ylpiperidin-1-yl)-2-pyridinyl]-4,6,8,10,11-pentazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-cyclopentyl-N-[5-(4-pyrrolidin-1-ylpiperidin-1-yl)-2-pyridinyl]-4,6,8,10,11-pentazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58300171 |
| Molecular Formula | C27H33N9 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 8-cyclopentyl-N-[5-(4-pyrrolidin-1-ylpiperidin-1-yl)-2-pyridinyl]-4,6,8,10,11-pentazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | c1cc2c3cnc(Nc4ccc(N5CCC(N6CCCC6)CC5)cn4)nc3n(C3CCCC3)c2nn1 |
| InChI | InChI=1S/C27H33N9/c1-2-6-20(5-1)36-25-23(22-9-12-30-33-26(22)36)18-29-27(32-25)31-24-8-7-21(17-28-24)35-15-10-19(11-16-35)34-13-3-4-14-34/h7-9,12,17-20H,1-6,10-11,13-16H2,(H,28,29,31,32) |
| InChIKey | FUEJYUAAPQRUCX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |